Products 1710674-50-2
CAS 1710674-50-2 is the registry number for 1-(5-Chloro-1-methyl-6-oxo-1,6-dihydropyridazin-4-yl)piperidine-3-carboxylic acid, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
1-(5-chloro-1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxylic acid (CAS 1710674-50-2) is a chemical compound with the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. IUPAC name: 1-(5-chloro-1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxylic acid. InChIKey: GXLJDCQBSHBTRZ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O3 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | 1-(5-chloro-1-methyl-6-oxopyridazin-4-yl)piperidine-3-carboxylic acid |
| InChIKey | GXLJDCQBSHBTRZ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(C=N1)N2CCCC(C2)C(=O)O)Cl |
Computed by PubChem (NCBI)