Products 202819-51-0
CAS 202819-51-0 appears in our catalog under these names: 1-[(4-Nitrophenyl)carbonyl]piperazine hydrochloride, 95%, 1-(4-Nitrobenzoyl)piperazine hydrochloride, 98%, 1-(4-Nitrobenzoyl)piperazine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
(4-nitrophenyl)-piperazin-1-ylmethanone;hydrochloride (CAS 202819-51-0) is a chemical compound with the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. IUPAC name: (4-nitrophenyl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: OGDUQVWZTNSTAC-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O3 |
|---|---|
| Molecular weight | 271.70 g/mol |
| IUPAC name | (4-nitrophenyl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | OGDUQVWZTNSTAC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)