CAS 1258002-30-0 is the registry number for Methyl 5-fluoro-2,3-dihydroxybenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-fluoro-2,3-dihydroxybenzoate (CAS 1258002-30-0) is a chemical compound with the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. IUPAC name: methyl 5-fluoro-2,3-dihydroxybenzoate. InChIKey: VIVYMMQRMMLFDP-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | methyl 5-fluoro-2,3-dihydroxybenzoate |
| InChIKey | VIVYMMQRMMLFDP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)F)O)O |
Computed by PubChem (NCBI)