Products 1258002-30-0

CAS 1258002-30-0 is the registry number for Methyl 5-fluoro-2,3-dihydroxybenzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Methyl 5-fluoro-2,3-dihydroxybenzoate (CAS 1258002-30-0) is a chemical compound with the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. IUPAC name: methyl 5-fluoro-2,3-dihydroxybenzoate. InChIKey: VIVYMMQRMMLFDP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7FO4
Molecular weight186.14 g/mol
IUPAC namemethyl 5-fluoro-2,3-dihydroxybenzoate
InChIKeyVIVYMMQRMMLFDP-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C(=CC(=C1)F)O)O

Computed by PubChem (NCBI)