CAS 1784962-35-1 appears in our catalog under these names: 3-Fluoro-2-hydroxy-4-methoxybenzoic acid, 98%, 98%, 3-FLUORO-2-HYDROXY-4-METHOXYBENZOIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg.
3-fluoro-2-hydroxy-4-methoxybenzoic acid (CAS 1784962-35-1) is a chemical compound with the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. IUPAC name: 3-fluoro-2-hydroxy-4-methoxybenzoic acid. InChIKey: GWHFANQHLUQEPI-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | 3-fluoro-2-hydroxy-4-methoxybenzoic acid |
| InChIKey | GWHFANQHLUQEPI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)O)F |
Computed by PubChem (NCBI)