CAS 492444-06-1 is the registry number for Methyl 6-fluoro-2,3-dihydroxybenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-fluoro-2,3-dihydroxybenzoate (CAS 492444-06-1) is a chemical compound with the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. IUPAC name: methyl 6-fluoro-2,3-dihydroxybenzoate. InChIKey: ATKNMUYEXNLVQT-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | methyl 6-fluoro-2,3-dihydroxybenzoate |
| InChIKey | ATKNMUYEXNLVQT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1O)O)F |
Computed by PubChem (NCBI)