CAS 1547742-53-9 is the registry number for 2-Fluoro-4-hydroxy-5-methoxybenzoic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-fluoro-4-hydroxy-5-methoxybenzoic acid (CAS 1547742-53-9) is a chemical compound with the molecular formula C8H7FO4 and a molecular weight of 186.14 g/mol. IUPAC name: 2-fluoro-4-hydroxy-5-methoxybenzoic acid. InChIKey: LGQNBTKEAASOGI-UHFFFAOYSA-N.
| Molecular formula | C8H7FO4 |
|---|---|
| Molecular weight | 186.14 g/mol |
| IUPAC name | 2-fluoro-4-hydroxy-5-methoxybenzoic acid |
| InChIKey | LGQNBTKEAASOGI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)F)O |
Computed by PubChem (NCBI)