Products 1258232-90-4
CAS 1258232-90-4 is the registry number for (S)-2,5-Dioxopyrrolidin-1-yl 2-(methoxycarbonylamino)-3-methylbutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-(methoxycarbonylamino)-3-methylbutanoate (CAS 1258232-90-4) is a chemical compound with the molecular formula C11H16N2O6 and a molecular weight of 272.25 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-(methoxycarbonylamino)-3-methylbutanoate. InChIKey: XFLHZYPNWQMHIL-VIFPVBQESA-N.
| Molecular formula | C11H16N2O6 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-(methoxycarbonylamino)-3-methylbutanoate |
| InChIKey | XFLHZYPNWQMHIL-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)OC |
Computed by PubChem (NCBI)