Products 61373-43-1
CAS 61373-43-1 is the registry number for 2'–Ethoxyuridine. Offered by: GLPBio. Available pack sizes: 200mg.
1-[(2R,3R,4R,5R)-3-ethoxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (CAS 61373-43-1) is a chemical compound with the molecular formula C11H16N2O6 and a molecular weight of 272.25 g/mol. IUPAC name: 1-[(2R,3R,4R,5R)-3-ethoxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione. InChIKey: PYUVPJPVFGNWDE-PEBGCTIMSA-N.
| Molecular formula | C11H16N2O6 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 1-[(2R,3R,4R,5R)-3-ethoxy-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| InChIKey | PYUVPJPVFGNWDE-PEBGCTIMSA-N |
| SMILES | CCO[C@@H]1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)CO)O |
Computed by PubChem (NCBI)
Synonyms:
2'-O-Ethyluridine, 2'-ethoxyuridine