CAS 5116-22-3 is the registry number for 5-Methoxymethyl-2'-deoxyuridine, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(methoxymethyl)pyrimidine-2,4-dione (CAS 5116-22-3) is a chemical compound with the molecular formula C11H16N2O6 and a molecular weight of 272.25 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(methoxymethyl)pyrimidine-2,4-dione. InChIKey: RSMISTTWWXJOOG-DJLDLDEBSA-N.
| Molecular formula | C11H16N2O6 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(methoxymethyl)pyrimidine-2,4-dione |
| InChIKey | RSMISTTWWXJOOG-DJLDLDEBSA-N |
| SMILES | COCC1=CN(C(=O)NC1=O)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)