Products 1821811-36-2
CAS 1821811-36-2 is the registry number for (R)-1-(Pyridin-2-yl)ethan-1-amine (2S,3S)-2,3-dihydroxysuccinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-ylethanamine (CAS 1821811-36-2) is a chemical compound with the molecular formula C11H16N2O6 and a molecular weight of 272.25 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-ylethanamine. InChIKey: CKUBHJSUJRDOFY-UOSDFWOXSA-N.
| Molecular formula | C11H16N2O6 |
|---|---|
| Molecular weight | 272.25 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;(1R)-1-pyridin-2-ylethanamine |
| InChIKey | CKUBHJSUJRDOFY-UOSDFWOXSA-N |
| SMILES | C[C@H](C1=CC=CC=N1)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)