Products 1258544-63-6
CAS 1258544-63-6 is the registry number for BVL3572S. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-amino-7-bromo-1-hydroxy-3,4-dihydroquinolin-2-one (CAS 1258544-63-6) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: (3S)-3-amino-7-bromo-1-hydroxy-3,4-dihydroquinolin-2-one. InChIKey: AAKHAIQDMUELMT-ZETCQYMHSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | (3S)-3-amino-7-bromo-1-hydroxy-3,4-dihydroquinolin-2-one |
| InChIKey | AAKHAIQDMUELMT-ZETCQYMHSA-N |
| SMILES | C1[C@@H](C(=O)N(C2=C1C=CC(=C2)Br)O)N |
Computed by PubChem (NCBI)