Products 1258600-65-5
CAS 1258600-65-5 is the registry number for 1,1,1,3,3,3-Hexafluoro-2-(o-tolyl)propan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1,1,3,3,3-hexafluoro-2-(2-methylphenyl)propan-2-ol (CAS 1258600-65-5) is a chemical compound with the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(2-methylphenyl)propan-2-ol. InChIKey: UFSHSKDCALTXOV-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(2-methylphenyl)propan-2-ol |
| InChIKey | UFSHSKDCALTXOV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)