Products 368-67-2
CAS 368-67-2 is the registry number for 1-ethoxy-3,5-bis(trifluoromethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-ethoxy-3,5-bis(trifluoromethyl)benzene (CAS 368-67-2) is a chemical compound with the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. IUPAC name: 1-ethoxy-3,5-bis(trifluoromethyl)benzene. InChIKey: NAUCMEORLXGXLA-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 1-ethoxy-3,5-bis(trifluoromethyl)benzene |
| InChIKey | NAUCMEORLXGXLA-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)