CAS 2010-61-9 appears in our catalog under these names: Hexafluoro-2-(p-tolyl)isopropanol, 95%, Hexafluoro-2-(p-tolyl)isopropanol. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 25g, 5g, 1g.
1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-ol (CAS 2010-61-9) is a chemical compound with the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. IUPAC name: 1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-ol. InChIKey: AOAVZPXKNQAALI-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexafluoro-2-(4-methylphenyl)propan-2-ol |
| InChIKey | AOAVZPXKNQAALI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)