Products 1265177-56-7
CAS 1265177-56-7 is the registry number for Aprepitant Impurity 50. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2,4-bis(trifluoromethyl)phenyl]ethanol (CAS 1265177-56-7) is a chemical compound with the molecular formula C10H8F6O and a molecular weight of 258.16 g/mol. IUPAC name: 1-[2,4-bis(trifluoromethyl)phenyl]ethanol. InChIKey: OCEYWVZDXHTIIZ-UHFFFAOYSA-N.
| Molecular formula | C10H8F6O |
|---|---|
| Molecular weight | 258.16 g/mol |
| IUPAC name | 1-[2,4-bis(trifluoromethyl)phenyl]ethanol |
| InChIKey | OCEYWVZDXHTIIZ-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F)O |
Computed by PubChem (NCBI)