Products 1258612-04-2
CAS 1258612-04-2 appears in our catalog under these names: 4–(4–Chlorophenyl)picolinic acid, 4-(4-Chlorophenyl)picolinic acid 95%, 4-(4-Chlorophenyl)picolinic acid, 95%, 95%, 4-(4-Chlorophenyl)picolinic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-(4-chlorophenyl)pyridine-2-carboxylic acid (CAS 1258612-04-2) is a chemical compound with the molecular formula C12H8ClNO2 and a molecular weight of 233.65 g/mol. IUPAC name: 4-(4-chlorophenyl)pyridine-2-carboxylic acid. InChIKey: STMWJUORSCVRKH-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO2 |
|---|---|
| Molecular weight | 233.65 g/mol |
| IUPAC name | 4-(4-chlorophenyl)pyridine-2-carboxylic acid |
| InChIKey | STMWJUORSCVRKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NC=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)