CAS 1258630-87-3 is the registry number for N-(8-Bromo-4-oxo-3,4-dihydroquinazolin-2-yl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(8-bromo-4-oxo-3H-quinazolin-2-yl)acetamide (CAS 1258630-87-3) is a chemical compound with the molecular formula C10H8BrN3O2 and a molecular weight of 282.09 g/mol. IUPAC name: N-(8-bromo-4-oxo-3H-quinazolin-2-yl)acetamide. InChIKey: LLSLGVNLBZYCDW-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O2 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | N-(8-bromo-4-oxo-3H-quinazolin-2-yl)acetamide |
| InChIKey | LLSLGVNLBZYCDW-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=NC2=C(C=CC=C2Br)C(=O)N1 |
Computed by PubChem (NCBI)