CAS 870703-96-1 is the registry number for 5-(4-Bromophenyl)isoxazole-3-carboxylic acid hydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5-(4-bromophenyl)-1,2-oxazole-3-carbohydrazide (CAS 870703-96-1) is a chemical compound with the molecular formula C10H8BrN3O2 and a molecular weight of 282.09 g/mol. IUPAC name: 5-(4-bromophenyl)-1,2-oxazole-3-carbohydrazide. InChIKey: MKPZSOFCTGFTNF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O2 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 5-(4-bromophenyl)-1,2-oxazole-3-carbohydrazide |
| InChIKey | MKPZSOFCTGFTNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=NO2)C(=O)NN)Br |
Computed by PubChem (NCBI)