Products 210159-10-7

CAS 210159-10-7 is the registry number for 1-(2-Bromophenyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

1-(2-bromophenyl)-5-methyltriazole-4-carboxylic acid (CAS 210159-10-7) is a chemical compound with the molecular formula C10H8BrN3O2 and a molecular weight of 282.09 g/mol. IUPAC name: 1-(2-bromophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: VZRDZUITJRPGNL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8BrN3O2
Molecular weight282.09 g/mol
IUPAC name1-(2-bromophenyl)-5-methyltriazole-4-carboxylic acid
InChIKeyVZRDZUITJRPGNL-UHFFFAOYSA-N
SMILESCC1=C(N=NN1C2=CC=CC=C2Br)C(=O)O

Computed by PubChem (NCBI)