CAS 210159-10-7 is the registry number for 1-(2-Bromophenyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-(2-bromophenyl)-5-methyltriazole-4-carboxylic acid (CAS 210159-10-7) is a chemical compound with the molecular formula C10H8BrN3O2 and a molecular weight of 282.09 g/mol. IUPAC name: 1-(2-bromophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: VZRDZUITJRPGNL-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O2 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 1-(2-bromophenyl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | VZRDZUITJRPGNL-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)