CAS 20725-34-2 appears in our catalog under these names: 1-(4-Bromophenyl)-5-methyl-1h-1,2,3-triazole-4-carboxylic acid, 95%, 1-(4-Bromophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid, 97%, 1–(4–Bromophenyl)–5–methyl–1H–1,2,3–triazole–4–carboxylic acid, 1-(4-Bromophenyl)-5-methyl-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 2,5g.
1-(4-bromophenyl)-5-methyltriazole-4-carboxylic acid (CAS 20725-34-2) is a chemical compound with the molecular formula C10H8BrN3O2 and a molecular weight of 282.09 g/mol. IUPAC name: 1-(4-bromophenyl)-5-methyltriazole-4-carboxylic acid. InChIKey: FPTYOFQUENAVEO-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O2 |
|---|---|
| Molecular weight | 282.09 g/mol |
| IUPAC name | 1-(4-bromophenyl)-5-methyltriazole-4-carboxylic acid |
| InChIKey | FPTYOFQUENAVEO-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NN1C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)