Products 1258639-50-7
CAS 1258639-50-7 appears in our catalog under these names: 1-(Pyridin-4-ylmethyl)piperidine-2-carboxylic acid dihydrochloride, 95%, 1-(Pyridin-4-ylmethyl)piperidine-2-carboxylic acid dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-(pyridin-4-ylmethyl)piperidine-2-carboxylic acid;dihydrochloride (CAS 1258639-50-7) is a chemical compound with the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. IUPAC name: 1-(pyridin-4-ylmethyl)piperidine-2-carboxylic acid;dihydrochloride. InChIKey: WEDRTLCTPMCZPA-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2O2 |
|---|---|
| Molecular weight | 293.19 g/mol |
| IUPAC name | 1-(pyridin-4-ylmethyl)piperidine-2-carboxylic acid;dihydrochloride |
| InChIKey | WEDRTLCTPMCZPA-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)CC2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)