CAS 38339-18-3 appears in our catalog under these names: Clenbuterol Impurity 7, Clenbuterol Impurity 12, Hydroxymethyl Clenbuterol, Hydroxymethylclenbuterol, Hydroxymethyl Clenbuterol, >95% (HPLC). Offered by: Hubei YoungXin, Chemat Brand, TRC, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 2,5mg, 1ml.
2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-methylpropan-1-ol (CAS 38339-18-3) is a chemical compound with the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. IUPAC name: 2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-methylpropan-1-ol. InChIKey: BWURCANZQUYPLR-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2O2 |
|---|---|
| Molecular weight | 293.19 g/mol |
| IUPAC name | 2-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]amino]-2-methylpropan-1-ol |
| InChIKey | BWURCANZQUYPLR-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O |
Computed by PubChem (NCBI)