CAS 86620-70-4 appears in our catalog under these names: 4-(Piperazinomethyl)benzoic Acid, Dihydrochloride, 4-(Piperazin-1-ylmethyl)benzoic acid dihydrochloride, 95%, 4-(Piperazin-1-ylmethyl)benzoic acid dihydrochloride, 95%, 95%, Piperazin-C-benzoic acid (dihydrochloride), 95.0%. Offered by: TRC, Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 500mg, 5g, 250mg, 1000mg, 2000mg, 5000mg, 10g, 1g.
4-(piperazin-1-ylmethyl)benzoic acid;dihydrochloride (CAS 86620-70-4) is a chemical compound with the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. IUPAC name: 4-(piperazin-1-ylmethyl)benzoic acid;dihydrochloride. InChIKey: FTYMSLWMAMSCLG-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2O2 |
|---|---|
| Molecular weight | 293.19 g/mol |
| IUPAC name | 4-(piperazin-1-ylmethyl)benzoic acid;dihydrochloride |
| InChIKey | FTYMSLWMAMSCLG-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC=C(C=C2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)