Products 2445784-27-8
CAS 2445784-27-8 is the registry number for 4-(4-Methylpiperazin-1-yl)benzoic acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-(4-methylpiperazin-1-yl)benzoic acid;dihydrochloride (CAS 2445784-27-8) is a chemical compound with the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. IUPAC name: 4-(4-methylpiperazin-1-yl)benzoic acid;dihydrochloride. InChIKey: VDPCKVRLCAFGHZ-UHFFFAOYSA-N.
| Molecular formula | C12H18Cl2N2O2 |
|---|---|
| Molecular weight | 293.19 g/mol |
| IUPAC name | 4-(4-methylpiperazin-1-yl)benzoic acid;dihydrochloride |
| InChIKey | VDPCKVRLCAFGHZ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)