Products 1258640-35-5
CAS 1258640-35-5 appears in our catalog under these names: 2-Chloro-N-{(3-(2,2,2-trifluoroethoxy)phenyl)methyl}acetamide, 95%, 2-Chloro-N-{(3-(2,2,2-trifluoroethoxy)phenyl)methyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide (CAS 1258640-35-5) is a chemical compound with the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. IUPAC name: 2-chloro-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide. InChIKey: SXZXUSFEHFDKLJ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3NO2 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 2-chloro-N-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]acetamide |
| InChIKey | SXZXUSFEHFDKLJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)CNC(=O)CCl |
Computed by PubChem (NCBI)