CAS 1443238-83-2 appears in our catalog under these names: 3-(3-Chlorophenyl)azetidine, trifluoroacetic acid, 95%, 3-(3-Chlorophenyl)azetidine trifluoroacetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3-chlorophenyl)azetidine;2,2,2-trifluoroacetic acid (CAS 1443238-83-2) is a chemical compound with the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. IUPAC name: 3-(3-chlorophenyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: QBYGSQZQMXSETO-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3NO2 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 3-(3-chlorophenyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | QBYGSQZQMXSETO-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC(=CC=C2)Cl.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)