CAS 1443238-27-4 is the registry number for 3-(4-Chlorophenyl)azetidine, trifluoroacetic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(4-chlorophenyl)azetidine;2,2,2-trifluoroacetic acid (CAS 1443238-27-4) is a chemical compound with the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. IUPAC name: 3-(4-chlorophenyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: AUUTZDCVCOSCJX-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3NO2 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 3-(4-chlorophenyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | AUUTZDCVCOSCJX-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=CC=C(C=C2)Cl.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)