CAS 1306604-49-8 appears in our catalog under these names: 2-Chloro-N-{1-(4-(trifluoromethoxy)phenyl)ethyl}acetamide, 95%, 2-Chloro-N-{1-(4-(trifluoromethoxy)phenyl)ethyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide (CAS 1306604-49-8) is a chemical compound with the molecular formula C11H11ClF3NO2 and a molecular weight of 281.66 g/mol. IUPAC name: 2-chloro-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide. InChIKey: QLZKQLKMOXKABO-UHFFFAOYSA-N.
| Molecular formula | C11H11ClF3NO2 |
|---|---|
| Molecular weight | 281.66 g/mol |
| IUPAC name | 2-chloro-N-[1-[4-(trifluoromethoxy)phenyl]ethyl]acetamide |
| InChIKey | QLZKQLKMOXKABO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)OC(F)(F)F)NC(=O)CCl |
Computed by PubChem (NCBI)