CAS 1258641-18-7 appears in our catalog under these names: 2-Amino-4,5-diethoxybenzoic acid hydrochloride, 95%, 2-Amino-4,5-diethoxybenzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g.
2-amino-4,5-diethoxybenzoic acid;hydrochloride (CAS 1258641-18-7) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: 2-amino-4,5-diethoxybenzoic acid;hydrochloride. InChIKey: CDPLSLZEVHETNS-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO4 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | 2-amino-4,5-diethoxybenzoic acid;hydrochloride |
| InChIKey | CDPLSLZEVHETNS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C(=O)O)N)OCC.Cl |
Computed by PubChem (NCBI)