CAS 1391448-08-0 is the registry number for (S)-2-Amino-3-(3,5-dimethoxy-phenyl)-propionic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride (CAS 1391448-08-0) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: (2S)-2-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride. InChIKey: ZUISSHJYZRLXRL-PPHPATTJSA-N.
| Molecular formula | C11H16ClNO4 |
|---|---|
| Molecular weight | 261.70 g/mol |
| IUPAC name | (2S)-2-amino-3-(3,5-dimethoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | ZUISSHJYZRLXRL-PPHPATTJSA-N |
| SMILES | COC1=CC(=CC(=C1)C[C@@H](C(=O)O)N)OC.Cl |
Computed by PubChem (NCBI)