Products 1192657-80-9

CAS 1192657-80-9 is the registry number for 3-(5-Amino-2,3-dimethoxyphenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(5-amino-2,3-dimethoxyphenyl)propanoic acid;hydrochloride (CAS 1192657-80-9) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: 3-(5-amino-2,3-dimethoxyphenyl)propanoic acid;hydrochloride. InChIKey: QGQCBKYLZZBNIP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO4
Molecular weight261.70 g/mol
IUPAC name3-(5-amino-2,3-dimethoxyphenyl)propanoic acid;hydrochloride
InChIKeyQGQCBKYLZZBNIP-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)CCC(=O)O)N.Cl

Computed by PubChem (NCBI)