Products 36412-23-4

CAS 36412-23-4 is the registry number for 3-Amino-3-(2,3-dimethoxyphenyl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-amino-3-(2,3-dimethoxyphenyl)propanoic acid;hydrochloride (CAS 36412-23-4) is a chemical compound with the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. IUPAC name: 3-amino-3-(2,3-dimethoxyphenyl)propanoic acid;hydrochloride. InChIKey: SNIJCLKTDPRJBA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO4
Molecular weight261.70 g/mol
IUPAC name3-amino-3-(2,3-dimethoxyphenyl)propanoic acid;hydrochloride
InChIKeySNIJCLKTDPRJBA-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1OC)C(CC(=O)O)N.Cl

Computed by PubChem (NCBI)