CAS 1258649-83-0 is the registry number for 2-(2-Aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(2-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid;dihydrochloride (CAS 1258649-83-0) is a chemical compound with the molecular formula C7H12Cl2N2O2S and a molecular weight of 259.15 g/mol. IUPAC name: 2-(2-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid;dihydrochloride. InChIKey: YEBLYBYAKSNJHJ-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | 2-(2-aminoethyl)-4-methyl-1,3-thiazole-5-carboxylic acid;dihydrochloride |
| InChIKey | YEBLYBYAKSNJHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CCN)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)