Products 1306603-28-0

CAS 1306603-28-0 is the registry number for Ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate;dihydrochloride (CAS 1306603-28-0) is a chemical compound with the molecular formula C7H12Cl2N2O2S and a molecular weight of 259.15 g/mol. IUPAC name: ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate;dihydrochloride. InChIKey: JCKGBHNJFBXEBI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12Cl2N2O2S
Molecular weight259.15 g/mol
IUPAC nameethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate;dihydrochloride
InChIKeyJCKGBHNJFBXEBI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=N1)CN.Cl.Cl

Computed by PubChem (NCBI)