CAS 1306603-28-0 is the registry number for Ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate;dihydrochloride (CAS 1306603-28-0) is a chemical compound with the molecular formula C7H12Cl2N2O2S and a molecular weight of 259.15 g/mol. IUPAC name: ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate;dihydrochloride. InChIKey: JCKGBHNJFBXEBI-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | ethyl 2-(aminomethyl)-1,3-thiazole-4-carboxylate;dihydrochloride |
| InChIKey | JCKGBHNJFBXEBI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CSC(=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)