CAS 1365964-53-9 appears in our catalog under these names: Methyl 2-(2-(aminomethyl)-1,3-thiazol-4-yl)acetate dihydrochloride, Methyl 2-(2-(aminomethyl)thiazol-4-yl)acetate dihydrochloride, 95%, 95%, Methyl 2-(2-(aminomethyl)thiazol-4-yl)acetate dihydrochloride, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
Methyl 2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetate;dihydrochloride (CAS 1365964-53-9) is a chemical compound with the molecular formula C7H12Cl2N2O2S and a molecular weight of 259.15 g/mol. IUPAC name: methyl 2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetate;dihydrochloride. InChIKey: OTADNPZWUSSZKV-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | methyl 2-[2-(aminomethyl)-1,3-thiazol-4-yl]acetate;dihydrochloride |
| InChIKey | OTADNPZWUSSZKV-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CSC(=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)