CAS 2126159-53-1 appears in our catalog under these names: (6-(Methylsulfonyl)pyridin-3-yl)methanamine dihydrochloride, 98%, (6-methanesulfonylpyridin-3-yl)methanamine dihydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
(6-methylsulfonyl-3-pyridinyl)methanamine;dihydrochloride (CAS 2126159-53-1) is a chemical compound with the molecular formula C7H12Cl2N2O2S and a molecular weight of 259.15 g/mol. IUPAC name: (6-methylsulfonyl-3-pyridinyl)methanamine;dihydrochloride. InChIKey: ZPBIHTBUSLOKOP-UHFFFAOYSA-N.
| Molecular formula | C7H12Cl2N2O2S |
|---|---|
| Molecular weight | 259.15 g/mol |
| IUPAC name | (6-methylsulfonyl-3-pyridinyl)methanamine;dihydrochloride |
| InChIKey | ZPBIHTBUSLOKOP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=NC=C(C=C1)CN.Cl.Cl |
Computed by PubChem (NCBI)