CAS 1258649-86-3 is the registry number for 3-(quinolin-8-yloxy)propan-1-amine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
3-quinolin-8-yloxypropan-1-amine;dihydrochloride (CAS 1258649-86-3) is a chemical compound with the molecular formula C12H16Cl2N2O and a molecular weight of 275.17 g/mol. IUPAC name: 3-quinolin-8-yloxypropan-1-amine;dihydrochloride. InChIKey: VSRJOLFYZVBUNM-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 3-quinolin-8-yloxypropan-1-amine;dihydrochloride |
| InChIKey | VSRJOLFYZVBUNM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)OCCCN)N=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)