CAS 1568455-19-5 is the registry number for (4-Chlorophenyl)(3-methylpiperazin-1-yl)methanone hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chlorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride (CAS 1568455-19-5) is a chemical compound with the molecular formula C12H16Cl2N2O and a molecular weight of 275.17 g/mol. IUPAC name: (4-chlorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride. InChIKey: FEHQPARSHRJNLP-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | (4-chlorophenyl)-(3-methylpiperazin-1-yl)methanone;hydrochloride |
| InChIKey | FEHQPARSHRJNLP-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C(=O)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)