Products 923178-45-4
CAS 923178-45-4 is the registry number for 2-(tert-Butylamino)-N-(2,5-dichlorophenyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(tert-butylamino)-N-(2,5-dichlorophenyl)acetamide (CAS 923178-45-4) is a chemical compound with the molecular formula C12H16Cl2N2O and a molecular weight of 275.17 g/mol. IUPAC name: 2-(tert-butylamino)-N-(2,5-dichlorophenyl)acetamide. InChIKey: YFTFRSCEAOVZAS-UHFFFAOYSA-N.
| Molecular formula | C12H16Cl2N2O |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | 2-(tert-butylamino)-N-(2,5-dichlorophenyl)acetamide |
| InChIKey | YFTFRSCEAOVZAS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)NC1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)