CAS 407640-11-3 is the registry number for (S)-(4-(3,4-Dichlorobenzyl)morpholin-2-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine (CAS 407640-11-3) is a chemical compound with the molecular formula C12H16Cl2N2O and a molecular weight of 275.17 g/mol. IUPAC name: [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine. InChIKey: UANWWXRZQGYWSR-JTQLQIEISA-N.
| Molecular formula | C12H16Cl2N2O |
|---|---|
| Molecular weight | 275.17 g/mol |
| IUPAC name | [(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methanamine |
| InChIKey | UANWWXRZQGYWSR-JTQLQIEISA-N |
| SMILES | C1CO[C@H](CN1CC2=CC(=C(C=C2)Cl)Cl)CN |
Computed by PubChem (NCBI)