CAS 1258650-04-2 appears in our catalog under these names: 2-(3-Aminopropyl)-4-methyl-1,3-thiazole-5-carboxylic acid dihydrochloride, 95%, 2-(3-Aminopropyl)-4-methyl-1,3-thiazole-5-carboxylic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-(3-aminopropyl)-4-methyl-1,3-thiazole-5-carboxylic acid;dihydrochloride (CAS 1258650-04-2) is a chemical compound with the molecular formula C8H14Cl2N2O2S and a molecular weight of 273.18 g/mol. IUPAC name: 2-(3-aminopropyl)-4-methyl-1,3-thiazole-5-carboxylic acid;dihydrochloride. InChIKey: NKKDJWHFHAIZTJ-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2S |
|---|---|
| Molecular weight | 273.18 g/mol |
| IUPAC name | 2-(3-aminopropyl)-4-methyl-1,3-thiazole-5-carboxylic acid;dihydrochloride |
| InChIKey | NKKDJWHFHAIZTJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CCCN)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)