CAS 1808473-09-7 appears in our catalog under these names: (2R)-2-{((2-methyl-1,3-thiazol-4-yl)methyl)amino}propanoic acid dihydrochloride, 95%, (2R)-2-{((2-Methyl-1,3-thiazol-4-yl)methyl)amino}propanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(2R)-2-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanoic acid;dihydrochloride (CAS 1808473-09-7) is a chemical compound with the molecular formula C8H14Cl2N2O2S and a molecular weight of 273.18 g/mol. IUPAC name: (2R)-2-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanoic acid;dihydrochloride. InChIKey: OEGGCFHKPFTJPT-ZJIMSODOSA-N.
| Molecular formula | C8H14Cl2N2O2S |
|---|---|
| Molecular weight | 273.18 g/mol |
| IUPAC name | (2R)-2-[(2-methyl-1,3-thiazol-4-yl)methylamino]propanoic acid;dihydrochloride |
| InChIKey | OEGGCFHKPFTJPT-ZJIMSODOSA-N |
| SMILES | CC1=NC(=CS1)CN[C@H](C)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)