CAS 2138106-79-1 is the registry number for Methyl 2-(2-aminoethyl)-5-methyl-1,3-thiazole-4-carboxylate dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(2-aminoethyl)-5-methyl-1,3-thiazole-4-carboxylate;dihydrochloride (CAS 2138106-79-1) is a chemical compound with the molecular formula C8H14Cl2N2O2S and a molecular weight of 273.18 g/mol. IUPAC name: methyl 2-(2-aminoethyl)-5-methyl-1,3-thiazole-4-carboxylate;dihydrochloride. InChIKey: FSWRRRVEEUKXJC-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2S |
|---|---|
| Molecular weight | 273.18 g/mol |
| IUPAC name | methyl 2-(2-aminoethyl)-5-methyl-1,3-thiazole-4-carboxylate;dihydrochloride |
| InChIKey | FSWRRRVEEUKXJC-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)CCN)C(=O)OC.Cl.Cl |
Computed by PubChem (NCBI)