CAS 1798732-60-1 appears in our catalog under these names: 3-Amino-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid dihydrochloride, 95%, 3-Amino-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-amino-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid;dihydrochloride (CAS 1798732-60-1) is a chemical compound with the molecular formula C8H14Cl2N2O2S and a molecular weight of 273.18 g/mol. IUPAC name: 3-amino-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid;dihydrochloride. InChIKey: HEOFAQKDEFJTMC-UHFFFAOYSA-N.
| Molecular formula | C8H14Cl2N2O2S |
|---|---|
| Molecular weight | 273.18 g/mol |
| IUPAC name | 3-amino-3-(2-methyl-1,3-thiazol-4-yl)butanoic acid;dihydrochloride |
| InChIKey | HEOFAQKDEFJTMC-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C(C)(CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)