Products 1258650-54-2
CAS 1258650-54-2 is the registry number for (5-(4-Methoxyphenyl)-1H-1,2,4-triazol-3-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride (CAS 1258650-54-2) is a chemical compound with the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. IUPAC name: [3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride. InChIKey: KNSWTTZYGZWZIV-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN4O |
|---|---|
| Molecular weight | 240.69 g/mol |
| IUPAC name | [3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methanamine;hydrochloride |
| InChIKey | KNSWTTZYGZWZIV-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NNC(=N2)CN.Cl |
Computed by PubChem (NCBI)