Products 1258650-80-4
CAS 1258650-80-4 is the registry number for 2-(4-Chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)acetonitrile (CAS 1258650-80-4) is a chemical compound with the molecular formula C14H17ClN2O and a molecular weight of 264.75 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)acetonitrile. InChIKey: PKFNACDCOLCOPK-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN2O |
|---|---|
| Molecular weight | 264.75 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)acetonitrile |
| InChIKey | PKFNACDCOLCOPK-UHFFFAOYSA-N |
| SMILES | CC1(CN(CCO1)C(C#N)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)