CAS 1258651-53-4 appears in our catalog under these names: 1-(5-(2-Methyl-1,3-thiazol-4-yl)thiophen-3-yl)ethan-1-one, 95%, 1-(5-(2-Methyl-1,3-thiazol-4-yl)thiophen-3-yl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-3-yl]ethanone (CAS 1258651-53-4) is a chemical compound with the molecular formula C10H9NOS2 and a molecular weight of 223.3 g/mol. IUPAC name: 1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-3-yl]ethanone. InChIKey: FZXISPBCPNJBJL-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 1-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-3-yl]ethanone |
| InChIKey | FZXISPBCPNJBJL-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CS1)C2=CC(=CS2)C(=O)C |
Computed by PubChem (NCBI)