CAS 56421-74-0 is the registry number for 1-(4-Methyl-2-(thiophen-3-yl)thiazol-5-yl)ethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanone (CAS 56421-74-0) is a chemical compound with the molecular formula C10H9NOS2 and a molecular weight of 223.3 g/mol. IUPAC name: 1-(4-methyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanone. InChIKey: GEGZKPFTVSVUDC-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 1-(4-methyl-2-thiophen-3-yl-1,3-thiazol-5-yl)ethanone |
| InChIKey | GEGZKPFTVSVUDC-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CSC=C2)C(=O)C |
Computed by PubChem (NCBI)