CAS 3919-81-1 is the registry number for 3-(4-Methylphenyl)-2-thioxo-1,3-thiazolidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 3919-81-1) is a chemical compound with the molecular formula C10H9NOS2 and a molecular weight of 223.3 g/mol. IUPAC name: 3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: UFIUHRONJXVXHC-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 3-(4-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | UFIUHRONJXVXHC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=O)CSC2=S |
Computed by PubChem (NCBI)