CAS 23522-38-5 is the registry number for 2-Thioxo-3-(m-tolyl)thiazolidin-4-one, 95+%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (CAS 23522-38-5) is a chemical compound with the molecular formula C10H9NOS2 and a molecular weight of 223.3 g/mol. IUPAC name: 3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one. InChIKey: SWXZAZUMBRCACD-UHFFFAOYSA-N.
| Molecular formula | C10H9NOS2 |
|---|---|
| Molecular weight | 223.3 g/mol |
| IUPAC name | 3-(3-methylphenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| InChIKey | SWXZAZUMBRCACD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=O)CSC2=S |
Computed by PubChem (NCBI)